CAS No. 20320-59-6
Chemical Name:Diethyl(phenylacetyl)malonateSynonymsCas 20320-59-6;new p;Propanedioic;20320 59 6;Phenylacetylmalonsaeurediethylester;diethyl 2-(2-phenylacetyl)propanedioate;diethyl 2-(2-phenylacetyl)propanedioate wickr bettyml;New BMK Oil;BMK Oil/powder;bmk Lliquid oilCBNumber:CB61075043Molecular Formula:C15H18O5Molecular Weight:278.3
Diethyl(phenylacetyl)malonate Properties
| Boiling point | 120 ¡ãC(Press: 0.01 Torr) |
|---|---|
| Density | 1.148¡À0.06 g/cm3(Predicted) |
| pka | 8.76¡À0.59(Predicted) |
| InChI | InChI=1S/C15H18O5/c1-3-19-14(17)13(15(18)20-4-2)12(16)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3 |
| InChIKey | ZASPDQDIPTZTQQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(C(CC1=CC=CC=C1)=O)C(OCC)=O |
Diethyl(phenylacetyl)malonate Chemical Properties,Uses,Production
Physical properties
Diethyl(phenylacetyl)malonate has a boiling point of 120 ¡ãC. Its density is predicted to be 1.148¡À0.06 g/cm3.
Uses
Organic synthesis intermediates.
Preparation
The anhydrous ethanol co-vaporized with diethyl phthalate and sodium metal is added dropwise to the mixture of diethyl malonate, carbon tetrachloride and magnesium, heated to start the reaction, and the temperature is controlled to smooth the reaction. Then add anhydrous diethyl ether, heat for 1h, add the diethyl ether solution of phenylacetyl chloride (add slowly, not to make the reaction too intense). After the reaction is completed, cool and add water, separate the oil layer, and evaporate the diethyl ether under reduced pressure to obtain diethyl(phenylacetyl)malonate.